related chemical

CAS 1033225-43-2 chemical formula,CAS 1033225-43-2 MSDS,CAS 1033225-43-2 chemical properties

CAS Number 1033225-43-2
chem name Benzenamine, 2,6-difluoro-N-(2-nitrophenyl)
formula C12H8F2N2O2
structure
synonyms 2,6-Difluoro-N-(2-nitrophenyl)aniline;
properties

CAS Number 1033225-43-2 properties (MSDS)

Specification

The Benzenamine, 2,6-difluoro-N-(2-nitrophenyl)-, with the CAS registry number 1033225-43-2, is also known as 2,6-Difluoro-N-(2-nitrophenyl)benzenamine. This chemical's molecular formula is C12H8F2N2O2 and molecular weight is 250.2. What's more, its systematic name is 2,6-difluoro-N-(2-nitrophenyl)aniline.

Physical properties of Benzenamine, 2,6-difluoro-N-(2-nitrophenyl)- are: (1)ACD/LogP: 4.89; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 4.89; (4)ACD/LogD (pH 7.4): 4.89; (5)ACD/BCF (pH 5.5): 3087.91; (6)ACD/BCF (pH 7.4): 3087.91; (7)ACD/KOC (pH 5.5): 10952.09; (8)ACD/KOC (pH 7.4): 10952.09; (9)#H bond acceptors: 4; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 3; (12)Polar Surface Area: 57.85 Å2; (13)Index of Refraction: 1.625 ; (14)Molar Refractivity: 62.16 cm3; (15)Molar Volume: 175.7 cm3; (16)Polarizability: 24.64×10-24cm3; (17)Surface Tension: 51.3 dyne/cm; (18)Density: 1.423 g/cm3; (19)Flash Point: 132.6 °C; (20)Enthalpy of Vaporization: 53.54 kJ/mol; (21)Boiling Point: 295.7 °C at 760 mmHg; (22)Vapour Pressure: 0.0015 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: c1ccc(c(c1)Nc2c(cccc2F)F)[N+](=O)[O-]
(2)InChI: InChI=1S/C12H8F2N2O2/c13-8-4-3-5-9(14)12(8)15-10-6-1-2-7-11(10)16(17)18/h1-7,15H
(3)InChIKey: SEWMPFVBNMCYHI-UHFFFAOYSA-N